C18H23N3O4 — CID 154906821
5-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]oxolan-2-one;formic acid (PubChem CID 154906821) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]oxolan-2-one;formic acid.
| Compound Name | 5-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]oxolan-2-one;formic acid |
|---|---|
| PubChem CID | 154906821 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 5-[[4-(1H-benzimidazol-2-yl)piperidin-1-yl]methyl]oxolan-2-one;formic acid |
| SMILES | O=C1CCC(CN2CCC(c3nc4ccccc4[nH]3)CC2)O1.O=CO |
| InChI | InChI=1S/C17H21N3O2.CH2O2/c21-16-6-5-13(22-16)11-20-9-7-12(8-10-20)17-18-14-3-1-2-4-15(14)19-17;2-1-3/h1-4,12-13H,5-11H2,(H,18,19);1H,(H,2,3) |
| InChIKey | XJCSXTOROIICDC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|