C20H23N3O4S — CID 154908933
formic acid;3-[(4-methyl-1,4-oxazepan-6-yl)methyl]-6-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 154908933) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is formic acid;3-[(4-methyl-1,4-oxazepan-6-yl)methyl]-6-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | formic acid;3-[(4-methyl-1,4-oxazepan-6-yl)methyl]-6-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 154908933 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | formic acid;3-[(4-methyl-1,4-oxazepan-6-yl)methyl]-6-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CN1CCOCC(Cn2cnc3sc(-c4ccccc4)cc3c2=O)C1.O=CO |
| InChI | InChI=1S/C19H21N3O2S.CH2O2/c1-21-7-8-24-12-14(10-21)11-22-13-20-18-16(19(22)23)9-17(25-18)15-5-3-2-4-6-15;2-1-3/h2-6,9,13-14H,7-8,10-12H2,1H3;1H,(H,2,3) |
| InChIKey | RXLXFUPTUZHPAR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|