C21H25N3O4S — CID 154909364
formic acid;3-[[1-(2-hydroxyethyl)piperidin-3-yl]methyl]-6-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 154909364) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is formic acid;3-[[1-(2-hydroxyethyl)piperidin-3-yl]methyl]-6-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | formic acid;3-[[1-(2-hydroxyethyl)piperidin-3-yl]methyl]-6-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 154909364 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | formic acid;3-[[1-(2-hydroxyethyl)piperidin-3-yl]methyl]-6-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | O=CO.O=c1c2cc(-c3ccccc3)sc2ncn1CC1CCCN(CCO)C1 |
| InChI | InChI=1S/C20H23N3O2S.CH2O2/c24-10-9-22-8-4-5-15(12-22)13-23-14-21-19-17(20(23)25)11-18(26-19)16-6-2-1-3-7-16;2-1-3/h1-3,6-7,11,14-15,24H,4-5,8-10,12-13H2;1H,(H,2,3) |
| InChIKey | WXYPCPYXCXPPHJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|