C20H29FN4O4 — CID 154909289
N-(1-ethylpiperidin-3-yl)-4-[(2-fluorophenyl)methyl]-3-oxopiperazine-1-carboxamide;formic acid (PubChem CID 154909289) has the molecular formula C20H29FN4O4 and a molecular weight of 408.47 g/mol. Its IUPAC name is N-(1-ethylpiperidin-3-yl)-4-[(2-fluorophenyl)methyl]-3-oxopiperazine-1-carboxamide;formic acid.
| Compound Name | N-(1-ethylpiperidin-3-yl)-4-[(2-fluorophenyl)methyl]-3-oxopiperazine-1-carboxamide;formic acid |
|---|---|
| PubChem CID | 154909289 |
| Molecular Formula | C20H29FN4O4 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-(1-ethylpiperidin-3-yl)-4-[(2-fluorophenyl)methyl]-3-oxopiperazine-1-carboxamide;formic acid |
| SMILES | CCN1CCCC(NC(=O)N2CCN(Cc3ccccc3F)C(=O)C2)C1.O=CO |
| InChI | InChI=1S/C19H27FN4O2.CH2O2/c1-2-22-9-5-7-16(13-22)21-19(26)24-11-10-23(18(25)14-24)12-15-6-3-4-8-17(15)20;2-1-3/h3-4,6,8,16H,2,5,7,9-14H2,1H3,(H,21,26);1H,(H,2,3) |
| InChIKey | KVRGCCPLNGRALO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|