C14H15N5O3S — CID 154909596
3-[3-(2-amino-1,3-thiazol-4-yl)propyl]pyrido[3,2-d]pyrimidin-4-one;formic acid (PubChem CID 154909596) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is 3-[3-(2-amino-1,3-thiazol-4-yl)propyl]pyrido[3,2-d]pyrimidin-4-one;formic acid.
| Compound Name | 3-[3-(2-amino-1,3-thiazol-4-yl)propyl]pyrido[3,2-d]pyrimidin-4-one;formic acid |
|---|---|
| PubChem CID | 154909596 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-[3-(2-amino-1,3-thiazol-4-yl)propyl]pyrido[3,2-d]pyrimidin-4-one;formic acid |
| SMILES | Nc1nc(CCCn2cnc3cccnc3c2=O)cs1.O=CO |
| InChI | InChI=1S/C13H13N5OS.CH2O2/c14-13-17-9(7-20-13)3-2-6-18-8-16-10-4-1-5-15-11(10)12(18)19;2-1-3/h1,4-5,7-8H,2-3,6H2,(H2,14,17);1H,(H,2,3) |
| InChIKey | QZGZJQTXQMIXLF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|