C19H23FN4O2 — CID 154914836
(1S,6R)-9-[6-(4-fluorophenyl)pyridazin-3-yl]-3-methyl-3,9-diazabicyclo[4.2.1]nonane;formic acid (PubChem CID 154914836) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is (1S,6R)-9-[6-(4-fluorophenyl)pyridazin-3-yl]-3-methyl-3,9-diazabicyclo[4.2.1]nonane;formic acid.
| Compound Name | (1S,6R)-9-[6-(4-fluorophenyl)pyridazin-3-yl]-3-methyl-3,9-diazabicyclo[4.2.1]nonane;formic acid |
|---|---|
| PubChem CID | 154914836 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1S,6R)-9-[6-(4-fluorophenyl)pyridazin-3-yl]-3-methyl-3,9-diazabicyclo[4.2.1]nonane;formic acid |
| SMILES | CN1CC[C@H]2CC[C@@H](C1)N2c1ccc(-c2ccc(F)cc2)nn1.O=CO |
| InChI | InChI=1S/C18H21FN4.CH2O2/c1-22-11-10-15-6-7-16(12-22)23(15)18-9-8-17(20-21-18)13-2-4-14(19)5-3-13;2-1-3/h2-5,8-9,15-16H,6-7,10-12H2,1H3;1H,(H,2,3)/t15-,16+;/m1./s1 |
| InChIKey | JLYYWGURBQOCEI-RCPFAERMSA-N |
| XLogP | 2.66 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|