C21H26Cl2F2N2 — CID 154917539
5-[(2,5-difluorophenyl)methyl]-3a-(2-phenylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 154917539) has the molecular formula C21H26Cl2F2N2 and a molecular weight of 415.36 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)methyl]-3a-(2-phenylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | 5-[(2,5-difluorophenyl)methyl]-3a-(2-phenylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 154917539 |
| Molecular Formula | C21H26Cl2F2N2 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 5-[(2,5-difluorophenyl)methyl]-3a-(2-phenylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | Cl.Cl.Fc1ccc(F)c(CN2CC3CNCC3(CCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H24F2N2.2ClH/c22-19-6-7-20(23)17(10-19)12-25-13-18-11-24-14-21(18,15-25)9-8-16-4-2-1-3-5-16;;/h1-7,10,18,24H,8-9,11-15H2;2*1H |
| InChIKey | RDWREJBYJRACAC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |