C21H25N3O4 — CID 154917736
formic acid;2-[1H-imidazol-2-ylmethyl-[(2-phenylmethoxyphenyl)methyl]amino]ethanol (PubChem CID 154917736) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is formic acid;2-[1H-imidazol-2-ylmethyl-[(2-phenylmethoxyphenyl)methyl]amino]ethanol.
| Compound Name | formic acid;2-[1H-imidazol-2-ylmethyl-[(2-phenylmethoxyphenyl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 154917736 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | formic acid;2-[1H-imidazol-2-ylmethyl-[(2-phenylmethoxyphenyl)methyl]amino]ethanol |
| SMILES | O=CO.OCCN(Cc1ncc[nH]1)Cc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C20H23N3O2.CH2O2/c24-13-12-23(15-20-21-10-11-22-20)14-18-8-4-5-9-19(18)25-16-17-6-2-1-3-7-17;2-1-3/h1-11,24H,12-16H2,(H,21,22);1H,(H,2,3) |
| InChIKey | NTGGNFWASKJXAH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|