C21H38N2O4 — CID 154917926
formic acid;1-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)ethanone (PubChem CID 154917926) has the molecular formula C21H38N2O4 and a molecular weight of 382.55 g/mol. Its IUPAC name is formic acid;1-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)ethanone.
| Compound Name | formic acid;1-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 154917926 |
| Molecular Formula | C21H38N2O4 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | formic acid;1-[(4R,5R)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]-2-(2,2,6,6-tetramethylpiperidin-4-yl)ethanone |
| SMILES | CC1(C)CC(CC(=O)N2CCC[C@]3(CCC[C@H]3O)C2)CC(C)(C)N1.O=CO |
| InChI | InChI=1S/C20H36N2O2.CH2O2/c1-18(2)12-15(13-19(3,4)21-18)11-17(24)22-10-6-9-20(14-22)8-5-7-16(20)23;2-1-3/h15-16,21,23H,5-14H2,1-4H3;1H,(H,2,3)/t16-,20-;/m1./s1 |
| InChIKey | RYOVCGZLFWTWHL-KYSFMIDTSA-N |
| XLogP | 2.79 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|