C22H27N5O4 — CID 154919142
formic acid;(4-propan-2-yloxyphenyl)-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]methanone (PubChem CID 154919142) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is formic acid;(4-propan-2-yloxyphenyl)-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]methanone.
| Compound Name | formic acid;(4-propan-2-yloxyphenyl)-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 154919142 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | formic acid;(4-propan-2-yloxyphenyl)-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1,4-diazepan-1-yl]methanone |
| SMILES | CC(C)Oc1ccc(C(=O)N2CCCN(c3ncnc4[nH]ccc34)CC2)cc1.O=CO |
| InChI | InChI=1S/C21H25N5O2.CH2O2/c1-15(2)28-17-6-4-16(5-7-17)21(27)26-11-3-10-25(12-13-26)20-18-8-9-22-19(18)23-14-24-20;2-1-3/h4-9,14-15H,3,10-13H2,1-2H3,(H,22,23,24);1H,(H,2,3) |
| InChIKey | UYSXRSVUUJBCJY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|