C20H25Cl2N3O2 — CID 154919884
(4aR,8aS)-6-[4-(1,3-benzodioxol-5-yl)-2-pyridinyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;dihydrochloride (PubChem CID 154919884) has the molecular formula C20H25Cl2N3O2 and a molecular weight of 410.35 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-(1,3-benzodioxol-5-yl)-2-pyridinyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;dihydrochloride.
| Compound Name | (4aR,8aS)-6-[4-(1,3-benzodioxol-5-yl)-2-pyridinyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;dihydrochloride |
|---|---|
| PubChem CID | 154919884 |
| Molecular Formula | C20H25Cl2N3O2 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (4aR,8aS)-6-[4-(1,3-benzodioxol-5-yl)-2-pyridinyl]-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cc(-c2ccc3c(c2)OCO3)cc(N2CC[C@@H]3NCCC[C@@H]3C2)n1 |
| InChI | InChI=1S/C20H23N3O2.2ClH/c1-2-16-12-23(9-6-17(16)21-7-1)20-11-15(5-8-22-20)14-3-4-18-19(10-14)25-13-24-18;;/h3-5,8,10-11,16-17,21H,1-2,6-7,9,12-13H2;2*1H/t16-,17+;;/m1../s1 |
| InChIKey | MLSVSNIGXYJOSC-LWPKXAGOSA-N |
| XLogP | 3.90 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |