C18H29N5O6S — CID 154922232
(6R,7R,8aR)-6-ethyl-N-(3-imidazol-1-ylpropyl)-2-methylsulfonyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide;formic acid (PubChem CID 154922232) has the molecular formula C18H29N5O6S and a molecular weight of 443.53 g/mol. Its IUPAC name is (6R,7R,8aR)-6-ethyl-N-(3-imidazol-1-ylpropyl)-2-methylsulfonyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide;formic acid.
| Compound Name | (6R,7R,8aR)-6-ethyl-N-(3-imidazol-1-ylpropyl)-2-methylsulfonyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide;formic acid |
|---|---|
| PubChem CID | 154922232 |
| Molecular Formula | C18H29N5O6S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (6R,7R,8aR)-6-ethyl-N-(3-imidazol-1-ylpropyl)-2-methylsulfonyl-4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide;formic acid |
| SMILES | CC[C@@H]1[C@H](C(=O)NCCCn2ccnc2)C[C@@H]2CN(S(C)(=O)=O)CC(=O)N21.O=CO |
| InChI | InChI=1S/C17H27N5O4S.CH2O2/c1-3-15-14(17(24)19-5-4-7-20-8-6-18-12-20)9-13-10-21(27(2,25)26)11-16(23)22(13)15;2-1-3/h6,8,12-15H,3-5,7,9-11H2,1-2H3,(H,19,24);1H,(H,2,3)/t13-,14-,15-;/m1./s1 |
| InChIKey | HUQBHETZJUWMEK-RFMLDLTKSA-N |
| XLogP | -0.64 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|