C10H20OS — CID 154925733
2-[(2R,5S)-2-methyl-5-propan-2-ylthiolan-2-yl]ethanol (PubChem CID 154925733) has the molecular formula C10H20OS and a molecular weight of 188.34 g/mol. Its IUPAC name is 2-[(2R,5S)-2-methyl-5-propan-2-ylthiolan-2-yl]ethanol.
| Compound Name | 2-[(2R,5S)-2-methyl-5-propan-2-ylthiolan-2-yl]ethanol |
|---|---|
| PubChem CID | 154925733 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-[(2R,5S)-2-methyl-5-propan-2-ylthiolan-2-yl]ethanol |
| SMILES | CC(C)[C@@H]1CC[C@](C)(CCO)S1 |
| InChI | InChI=1S/C10H20OS/c1-8(2)9-4-5-10(3,12-9)6-7-11/h8-9,11H,4-7H2,1-3H3/t9-,10+/m0/s1 |
| InChIKey | XFOGVCZMBNJHTB-VHSXEESVSA-N |
| XLogP | 2.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |