C21H34FN3O3 — CID 154932378
(Z,4E)-4-(2-fluoroethylidene)-3,3-dimethyl-2-(methylamino)-N-[1-[methyl-[(E)-3-methyl-4-oxobut-2-enyl]amino]-1-oxopropan-2-yl]hept-5-enamide (PubChem CID 154932378) has the molecular formula C21H34FN3O3 and a molecular weight of 395.52 g/mol. Its IUPAC name is (Z,4E)-4-(2-fluoroethylidene)-3,3-dimethyl-2-(methylamino)-N-[1-[methyl-[(E)-3-methyl-4-oxobut-2-enyl]amino]-1-oxopropan-2-yl]hept-5-enamide.
| Compound Name | (Z,4E)-4-(2-fluoroethylidene)-3,3-dimethyl-2-(methylamino)-N-[1-[methyl-[(E)-3-methyl-4-oxobut-2-enyl]amino]-1-oxopropan-2-yl]hept-5-enamide |
|---|---|
| PubChem CID | 154932378 |
| Molecular Formula | C21H34FN3O3 |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (Z,4E)-4-(2-fluoroethylidene)-3,3-dimethyl-2-(methylamino)-N-[1-[methyl-[(E)-3-methyl-4-oxobut-2-enyl]amino]-1-oxopropan-2-yl]hept-5-enamide |
| SMILES | C/C=C\C(=C/CF)C(C)(C)C(NC)C(=O)NC(C)C(=O)N(C)C/C=C(\C)C=O |
| InChI | InChI=1S/C21H34FN3O3/c1-8-9-17(10-12-22)21(4,5)18(23-6)19(27)24-16(3)20(28)25(7)13-11-15(2)14-26/h8-11,14,16,18,23H,12-13H2,1-7H3,(H,24,27)/b9-8-,15-11+,17-10+ |
| InChIKey | UGEXQCMJGVIEAG-VFXVGTQKSA-N |
| XLogP | 2.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|