C17H22ClN3O2 — CID 154932711
3-chloro-2,5-dimethyl-N-(1,1,3-trimethyl-3H-2-benzofuran-4-yl)-1,5-dihydropyrazole-4-carboxamide (PubChem CID 154932711) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 3-chloro-2,5-dimethyl-N-(1,1,3-trimethyl-3H-2-benzofuran-4-yl)-1,5-dihydropyrazole-4-carboxamide.
| Compound Name | 3-chloro-2,5-dimethyl-N-(1,1,3-trimethyl-3H-2-benzofuran-4-yl)-1,5-dihydropyrazole-4-carboxamide |
|---|---|
| PubChem CID | 154932711 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 3-chloro-2,5-dimethyl-N-(1,1,3-trimethyl-3H-2-benzofuran-4-yl)-1,5-dihydropyrazole-4-carboxamide |
| SMILES | CC1NN(C)C(Cl)=C1C(=O)Nc1cccc2c1C(C)OC2(C)C |
| InChI | InChI=1S/C17H22ClN3O2/c1-9-13(15(18)21(5)20-9)16(22)19-12-8-6-7-11-14(12)10(2)23-17(11,3)4/h6-10,20H,1-5H3,(H,19,22) |
| InChIKey | FTKDVTVSNMVTLG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|