C32H12N6 — CID 154936566
2-[13-(dicyanomethylidene)-15,16-diazaheptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaen-28-ylidene]propanedinitrile (PubChem CID 154936566) has the molecular formula C32H12N6 and a molecular weight of 480.49 g/mol. Its IUPAC name is 2-[13-(dicyanomethylidene)-15,16-diazaheptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaen-28-ylidene]propanedinitrile.
| Compound Name | 2-[13-(dicyanomethylidene)-15,16-diazaheptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaen-28-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 154936566 |
| Molecular Formula | C32H12N6 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-[13-(dicyanomethylidene)-15,16-diazaheptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaen-28-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1c2ccc3ccccc3c2-c2c1nnc1c2C(=C(C#N)C#N)c2ccc3ccccc3c2-1 |
| InChI | InChI=1S/C32H12N6/c33-13-19(14-34)25-23-11-9-18-6-2-4-8-22(18)28(23)32-29(25)30-27-21-7-3-1-5-17(21)10-12-24(27)26(20(15-35)16-36)31(30)37-38-32/h1-12H |
| InChIKey | MHGJFFWCKNSIEC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 120.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|