C36H16F4N4 — CID 142501638
2-[13-(dicyanomethylidene)-10,15,16,25-tetrafluoro-28-heptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaenylidene]propanedinitrile;ethane (PubChem CID 142501638) has the molecular formula C36H16F4N4 and a molecular weight of 580.54 g/mol. Its IUPAC name is 2-[13-(dicyanomethylidene)-10,15,16,25-tetrafluoro-28-heptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaenylidene]propanedinitrile;ethane.
| Compound Name | 2-[13-(dicyanomethylidene)-10,15,16,25-tetrafluoro-28-heptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaenylidene]propanedinitrile;ethane |
|---|---|
| PubChem CID | 142501638 |
| Molecular Formula | C36H16F4N4 |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | 2-[13-(dicyanomethylidene)-10,15,16,25-tetrafluoro-28-heptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaenylidene]propanedinitrile;ethane |
| SMILES | CC.N#CC(C#N)=C1c2cc(F)c3ccccc3c2-c2c1c(F)c(F)c1c2C(=C(C#N)C#N)c2cc(F)c3ccccc3c2-1 |
| InChI | InChI=1S/C34H10F4N4.C2H6/c35-23-9-21-25(15(11-39)12-40)29-30-27-19-7-3-1-5-17(19)24(36)10-22(27)26(16(13-41)14-42)31(30)33(37)34(38)32(29)28(21)20-8-4-2-6-18(20)23;1-2/h1-10H;1-2H3 |
| InChIKey | SETIPSKUYHAWGY-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|