C31H13F4NO — CID 154936776
(2E)-2-(10,15,16,25-tetrafluoro-28-oxo-13-heptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaenylidene)propanenitrile (PubChem CID 154936776) has the molecular formula C31H13F4NO and a molecular weight of 491.44 g/mol. Its IUPAC name is (2E)-2-(10,15,16,25-tetrafluoro-28-oxo-13-heptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaenylidene)propanenitrile.
| Compound Name | (2E)-2-(10,15,16,25-tetrafluoro-28-oxo-13-heptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaenylidene)propanenitrile |
|---|---|
| PubChem CID | 154936776 |
| Molecular Formula | C31H13F4NO |
| Molecular Weight | 491.44 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | (2E)-2-(10,15,16,25-tetrafluoro-28-oxo-13-heptacyclo[15.11.0.02,14.03,12.04,9.018,27.019,24]octacosa-1,3(12),4,6,8,10,14,16,18(27),19,21,23,25-tridecaenylidene)propanenitrile |
| SMILES | C/C(C#N)=C1/c2cc(F)c3ccccc3c2-c2c3c(c(F)c(F)c21)-c1c(cc(F)c2ccccc12)C3=O |
| InChI | InChI=1S/C31H13F4NO/c1-13(12-36)22-18-10-20(32)14-6-2-4-8-16(14)23(18)25-26(22)29(34)30(35)27-24-17-9-5-3-7-15(17)21(33)11-19(24)31(37)28(25)27/h2-11H,1H3/b22-13+ |
| InChIKey | QNHJSYQPQUUFHW-LPYMAVHISA-N |
| XLogP | 8.09 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.44 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|