C26H9F3N4 — CID 174300480
2-[(2E)-3-(cyanomethylidene)-5,6,7-trifluoro-2-indeno[1,2-b]pyridin-5-ylideneinden-1-ylidene]propanedinitrile (PubChem CID 174300480) has the molecular formula C26H9F3N4 and a molecular weight of 434.38 g/mol. Its IUPAC name is 2-[(2E)-3-(cyanomethylidene)-5,6,7-trifluoro-2-indeno[1,2-b]pyridin-5-ylideneinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2E)-3-(cyanomethylidene)-5,6,7-trifluoro-2-indeno[1,2-b]pyridin-5-ylideneinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174300480 |
| Molecular Formula | C26H9F3N4 |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-[(2E)-3-(cyanomethylidene)-5,6,7-trifluoro-2-indeno[1,2-b]pyridin-5-ylideneinden-1-ylidene]propanedinitrile |
| SMILES | N#CC=C1/C(=C2/c3ccccc3-c3ncccc32)C(=C(C#N)C#N)c2c1cc(F)c(F)c2F |
| InChI | InChI=1S/C26H9F3N4/c27-19-10-18-15(7-8-30)22(20(13(11-31)12-32)23(18)25(29)24(19)28)21-14-4-1-2-5-16(14)26-17(21)6-3-9-33-26/h1-7,9-10H/b15-7?,22-21+ |
| InChIKey | HLDUWOZFFWHKKJ-YGQSEEBMSA-N |
| XLogP | 5.70 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|