C24H8F3N3O — CID 174300428
2-[(2Z)-4,5,7-trifluoro-2-indeno[1,2-b]pyridin-5-ylidene-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 174300428) has the molecular formula C24H8F3N3O and a molecular weight of 411.34 g/mol. Its IUPAC name is 2-[(2Z)-4,5,7-trifluoro-2-indeno[1,2-b]pyridin-5-ylidene-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-4,5,7-trifluoro-2-indeno[1,2-b]pyridin-5-ylidene-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174300428 |
| Molecular Formula | C24H8F3N3O |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 2-[(2Z)-4,5,7-trifluoro-2-indeno[1,2-b]pyridin-5-ylidene-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C2\c3ccccc3-c3ncccc32)C(=O)c2c(F)c(F)cc(F)c21 |
| InChI | InChI=1S/C24H8F3N3O/c25-15-8-16(26)22(27)21-19(15)17(11(9-28)10-29)20(24(21)31)18-12-4-1-2-5-13(12)23-14(18)6-3-7-30-23/h1-8H/b20-18- |
| InChIKey | JOFHGVMBQURHJC-ZZEZOPTASA-N |
| XLogP | 4.98 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|