C22H8F3N3O — CID 174301461
(2Z)-2-[2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-4,6,7-trifluoro-3-oxoinden-1-ylidene]acetonitrile (PubChem CID 174301461) has the molecular formula C22H8F3N3O and a molecular weight of 387.32 g/mol. Its IUPAC name is (2Z)-2-[2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-4,6,7-trifluoro-3-oxoinden-1-ylidene]acetonitrile.
| Compound Name | (2Z)-2-[2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-4,6,7-trifluoro-3-oxoinden-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 174301461 |
| Molecular Formula | C22H8F3N3O |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (2Z)-2-[2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-4,6,7-trifluoro-3-oxoinden-1-ylidene]acetonitrile |
| SMILES | N#C/C=C1/C(=C2c3cccnc3-c3ncccc32)C(=O)c2c(F)cc(F)c(F)c21 |
| InChI | InChI=1S/C22H8F3N3O/c23-13-9-14(24)19(25)16-10(5-6-26)17(22(29)18(13)16)15-11-3-1-7-27-20(11)21-12(15)4-2-8-28-21/h1-5,7-9H/b10-5+ |
| InChIKey | DUTBPHFBDBOWGI-BJMVGYQFSA-N |
| XLogP | 4.48 |
| TPSA | 66.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|