C24H10FN3O — CID 174300386
2-[(2Z)-4-fluoro-2-indeno[1,2-b]pyridin-5-ylidene-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 174300386) has the molecular formula C24H10FN3O and a molecular weight of 375.36 g/mol. Its IUPAC name is 2-[(2Z)-4-fluoro-2-indeno[1,2-b]pyridin-5-ylidene-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-4-fluoro-2-indeno[1,2-b]pyridin-5-ylidene-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174300386 |
| Molecular Formula | C24H10FN3O |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 2-[(2Z)-4-fluoro-2-indeno[1,2-b]pyridin-5-ylidene-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C2\c3ccccc3-c3ncccc32)C(=O)c2c(F)cccc21 |
| InChI | InChI=1S/C24H10FN3O/c25-18-9-3-7-16-19(13(11-26)12-27)22(24(29)21(16)18)20-14-5-1-2-6-15(14)23-17(20)8-4-10-28-23/h1-10H/b22-20- |
| InChIKey | WNKJIWZDHXJKBJ-XDOYNYLZSA-N |
| XLogP | 4.70 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|