C27H11N5O — CID 174300852
2-[3-(dicyanomethylidene)-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)inden-1-ylidene]propanedinitrile (PubChem CID 174300852) has the molecular formula C27H11N5O and a molecular weight of 421.42 g/mol. Its IUPAC name is 2-[3-(dicyanomethylidene)-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[3-(dicyanomethylidene)-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174300852 |
| Molecular Formula | C27H11N5O |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 2-[3-(dicyanomethylidene)-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)inden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C(=C2c3cccnc3-c3c(O)cccc32)C(=C(C#N)C#N)c2ccccc21 |
| InChI | InChI=1S/C27H11N5O/c28-11-15(12-29)22-17-5-1-2-6-18(17)23(16(13-30)14-31)26(22)24-19-7-3-9-21(33)25(19)27-20(24)8-4-10-32-27/h1-10,33H |
| InChIKey | OHQBWWFDOCHGCJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|