C27H8F3N5O — CID 174300908
2-[(2Z)-3-(dicyanomethylidene)-4,5,7-trifluoro-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)inden-1-ylidene]propanedinitrile (PubChem CID 174300908) has the molecular formula C27H8F3N5O and a molecular weight of 475.39 g/mol. Its IUPAC name is 2-[(2Z)-3-(dicyanomethylidene)-4,5,7-trifluoro-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-3-(dicyanomethylidene)-4,5,7-trifluoro-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174300908 |
| Molecular Formula | C27H8F3N5O |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | 2-[(2Z)-3-(dicyanomethylidene)-4,5,7-trifluoro-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)inden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C2/c3cccnc3-c3c(O)cccc32)C(=C(C#N)C#N)c2c(F)c(F)cc(F)c21 |
| InChI | InChI=1S/C27H8F3N5O/c28-16-7-17(29)26(30)25-20(13(10-33)11-34)24(19(23(16)25)12(8-31)9-32)21-14-3-1-5-18(36)22(14)27-15(21)4-2-6-35-27/h1-7,36H/b24-21- |
| InChIKey | GHMFOUDZFFNXQX-FLFQWRMESA-N |
| XLogP | 5.30 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|