C24H9F2N3O2 — CID 174300717
2-[(2Z)-5,7-difluoro-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 174300717) has the molecular formula C24H9F2N3O2 and a molecular weight of 409.35 g/mol. Its IUPAC name is 2-[(2Z)-5,7-difluoro-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-5,7-difluoro-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174300717 |
| Molecular Formula | C24H9F2N3O2 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-[(2Z)-5,7-difluoro-2-(9-hydroxyindeno[1,2-b]pyridin-5-ylidene)-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C2/c3cccnc3-c3c(O)cccc32)C(=O)c2cc(F)cc(F)c21 |
| InChI | InChI=1S/C24H9F2N3O2/c25-12-7-15-20(16(26)8-12)18(11(9-27)10-28)22(24(15)31)19-13-3-1-5-17(30)21(13)23-14(19)4-2-6-29-23/h1-8,30H/b22-19- |
| InChIKey | VBSDTXXMNBJXKF-QOCHGBHMSA-N |
| XLogP | 4.54 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|