C20H10F2N2 — CID 174199202
(2E)-2-(2,4-difluorophenyl)-2-indeno[1,2-b]pyridin-5-ylideneacetonitrile (PubChem CID 174199202) has the molecular formula C20H10F2N2 and a molecular weight of 316.31 g/mol. Its IUPAC name is (2E)-2-(2,4-difluorophenyl)-2-indeno[1,2-b]pyridin-5-ylideneacetonitrile.
| Compound Name | (2E)-2-(2,4-difluorophenyl)-2-indeno[1,2-b]pyridin-5-ylideneacetonitrile |
|---|---|
| PubChem CID | 174199202 |
| Molecular Formula | C20H10F2N2 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (2E)-2-(2,4-difluorophenyl)-2-indeno[1,2-b]pyridin-5-ylideneacetonitrile |
| SMILES | N#C/C(=C1\c2ccccc2-c2ncccc21)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H10F2N2/c21-12-7-8-13(18(22)10-12)17(11-23)19-14-4-1-2-5-15(14)20-16(19)6-3-9-24-20/h1-10H/b19-17- |
| InChIKey | ILODSPCZBZUUTL-ZPHPHTNESA-N |
| XLogP | 4.82 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|