C20H9FN4 — CID 174199163
4-[cyano(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)methyl]-2-fluorobenzonitrile (PubChem CID 174199163) has the molecular formula C20H9FN4 and a molecular weight of 324.32 g/mol. Its IUPAC name is 4-[cyano(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)methyl]-2-fluorobenzonitrile.
| Compound Name | 4-[cyano(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 174199163 |
| Molecular Formula | C20H9FN4 |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-[cyano(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)methyl]-2-fluorobenzonitrile |
| SMILES | N#CC(=C1c2cccnc2-c2ncccc21)c1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C20H9FN4/c21-17-9-12(5-6-13(17)10-22)16(11-23)18-14-3-1-7-24-19(14)20-15(18)4-2-8-25-20/h1-9H |
| InChIKey | HNPDOJDBAYFQCH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|