C16H8N2O4 — CID 10756037
(2Z)-2-(1,3-benzodioxol-5-yl)-2-(5-oxofuro[3,4-b]pyridin-7-ylidene)acetonitrile (PubChem CID 10756037) has the molecular formula C16H8N2O4 and a molecular weight of 292.25 g/mol. Its IUPAC name is (2Z)-2-(1,3-benzodioxol-5-yl)-2-(5-oxofuro[3,4-b]pyridin-7-ylidene)acetonitrile.
| Compound Name | (2Z)-2-(1,3-benzodioxol-5-yl)-2-(5-oxofuro[3,4-b]pyridin-7-ylidene)acetonitrile |
|---|---|
| PubChem CID | 10756037 |
| Molecular Formula | C16H8N2O4 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | (2Z)-2-(1,3-benzodioxol-5-yl)-2-(5-oxofuro[3,4-b]pyridin-7-ylidene)acetonitrile |
| SMILES | N#C/C(=C1\OC(=O)c2cccnc21)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H8N2O4/c17-7-11(9-3-4-12-13(6-9)21-8-20-12)15-14-10(16(19)22-15)2-1-5-18-14/h1-6H,8H2/b15-11+ |
| InChIKey | XILWCFGUFKNEML-RVDMUPIBSA-N |
| XLogP | 2.37 |
| TPSA | 81.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|