C23H8F2N4O — CID 174301523
2-[2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-6,7-difluoro-3-oxoinden-1-ylidene]propanedinitrile (PubChem CID 174301523) has the molecular formula C23H8F2N4O and a molecular weight of 394.34 g/mol. Its IUPAC name is 2-[2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-6,7-difluoro-3-oxoinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-6,7-difluoro-3-oxoinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174301523 |
| Molecular Formula | C23H8F2N4O |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 2-[2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-6,7-difluoro-3-oxoinden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C(=C2c3cccnc3-c3ncccc32)C(=O)c2ccc(F)c(F)c21 |
| InChI | InChI=1S/C23H8F2N4O/c24-15-6-5-14-18(20(15)25)16(11(9-26)10-27)19(23(14)30)17-12-3-1-7-28-21(12)22-13(17)4-2-8-29-22/h1-8H |
| InChIKey | FYHYGOIBUNBMPA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 90.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|