C25H9F2N5 — CID 174300202
2-[(3Z)-3-(cyanomethylidene)-2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-4,7-difluoroinden-1-ylidene]propanedinitrile (PubChem CID 174300202) has the molecular formula C25H9F2N5 and a molecular weight of 417.38 g/mol. Its IUPAC name is 2-[(3Z)-3-(cyanomethylidene)-2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-4,7-difluoroinden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(3Z)-3-(cyanomethylidene)-2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-4,7-difluoroinden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174300202 |
| Molecular Formula | C25H9F2N5 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 2-[(3Z)-3-(cyanomethylidene)-2-(3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ylidene)-4,7-difluoroinden-1-ylidene]propanedinitrile |
| SMILES | N#C/C=C1/C(=C2c3cccnc3-c3ncccc32)C(=C(C#N)C#N)c2c(F)ccc(F)c21 |
| InChI | InChI=1S/C25H9F2N5/c26-17-5-6-18(27)23-19(13(11-29)12-30)22(14(7-8-28)21(17)23)20-15-3-1-9-31-24(15)25-16(20)4-2-10-32-25/h1-7,9-10H/b14-7+ |
| InChIKey | ASCXNRKNRAFVNI-VGOFMYFVSA-N |
| XLogP | 4.96 |
| TPSA | 97.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|