C15H24N4 — CID 154936668
7-(5-methylnonan-5-yl)-[1,2,4]triazolo[4,3-c]pyrimidine (PubChem CID 154936668) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 7-(5-methylnonan-5-yl)-[1,2,4]triazolo[4,3-c]pyrimidine.
| Compound Name | 7-(5-methylnonan-5-yl)-[1,2,4]triazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 154936668 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 7-(5-methylnonan-5-yl)-[1,2,4]triazolo[4,3-c]pyrimidine |
| SMILES | CCCCC(C)(CCCC)c1cc2nncn2cn1 |
| InChI | InChI=1S/C15H24N4/c1-4-6-8-15(3,9-7-5-2)13-10-14-18-17-12-19(14)11-16-13/h10-12H,4-9H2,1-3H3 |
| InChIKey | PBBHADFPXWGYKG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |