C11H15N3O — CID 71479874
5-pentoxy-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 71479874) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-pentoxy-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 5-pentoxy-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 71479874 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 5-pentoxy-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CCCCCOc1cccc2nncn12 |
| InChI | InChI=1S/C11H15N3O/c1-2-3-4-8-15-11-7-5-6-10-13-12-9-14(10)11/h5-7,9H,2-4,8H2,1H3 |
| InChIKey | OLFFMPJMKSLSCZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|