C21H21F3N2O6 — CID 154940749
2-[2-amino-3-(2,4-dimethylphenoxy)propoxy]isoindole-1,3-dione;2,2,2-trifluoroacetic acid (PubChem CID 154940749) has the molecular formula C21H21F3N2O6 and a molecular weight of 454.40 g/mol. Its IUPAC name is 2-[2-amino-3-(2,4-dimethylphenoxy)propoxy]isoindole-1,3-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-amino-3-(2,4-dimethylphenoxy)propoxy]isoindole-1,3-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154940749 |
| Molecular Formula | C21H21F3N2O6 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 2-[2-amino-3-(2,4-dimethylphenoxy)propoxy]isoindole-1,3-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(OCC(N)CON2C(=O)c3ccccc3C2=O)c(C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H20N2O4.C2HF3O2/c1-12-7-8-17(13(2)9-12)24-10-14(20)11-25-21-18(22)15-5-3-4-6-16(15)19(21)23;3-2(4,5)1(6)7/h3-9,14H,10-11,20H2,1-2H3;(H,6,7) |
| InChIKey | NBPAPDBGGAQDMY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|