C16H16N4O4 — CID 154942548
(E)-1,1-bis(2-nitrophenyl)but-2-ene-1,4-diamine (PubChem CID 154942548) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is (E)-1,1-bis(2-nitrophenyl)but-2-ene-1,4-diamine.
| Compound Name | (E)-1,1-bis(2-nitrophenyl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 154942548 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (E)-1,1-bis(2-nitrophenyl)but-2-ene-1,4-diamine |
| SMILES | NC/C=C/C(N)(c1ccccc1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N4O4/c17-11-5-10-16(18,12-6-1-3-8-14(12)19(21)22)13-7-2-4-9-15(13)20(23)24/h1-10H,11,17-18H2/b10-5+ |
| InChIKey | ARIREJVKZGYCOT-BJMVGYQFSA-N |
| XLogP | 2.22 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|