C9H7Cl2N3O4S — CID 173426152
[1,1-dichloro-1-(2-nitrophenyl)-3-sulfonylpropan-2-ylidene]hydrazine (PubChem CID 173426152) has the molecular formula C9H7Cl2N3O4S and a molecular weight of 324.15 g/mol. Its IUPAC name is [1,1-dichloro-1-(2-nitrophenyl)-3-sulfonylpropan-2-ylidene]hydrazine.
| Compound Name | [1,1-dichloro-1-(2-nitrophenyl)-3-sulfonylpropan-2-ylidene]hydrazine |
|---|---|
| PubChem CID | 173426152 |
| Molecular Formula | C9H7Cl2N3O4S |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | [1,1-dichloro-1-(2-nitrophenyl)-3-sulfonylpropan-2-ylidene]hydrazine |
| SMILES | NN=C(C=S(=O)=O)C(Cl)(Cl)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7Cl2N3O4S/c10-9(11,8(13-12)5-19(17)18)6-3-1-2-4-7(6)14(15)16/h1-5H,12H2 |
| InChIKey | CXGHFUZQCSLMJK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|