C34H59N3 — CID 154946377
2-(5-methyldodecan-5-yl)-4-(7-methyltridecan-7-yl)pyrido[3,2-d]pyrimidine (PubChem CID 154946377) has the molecular formula C34H59N3 and a molecular weight of 509.87 g/mol. Its IUPAC name is 2-(5-methyldodecan-5-yl)-4-(7-methyltridecan-7-yl)pyrido[3,2-d]pyrimidine.
| Compound Name | 2-(5-methyldodecan-5-yl)-4-(7-methyltridecan-7-yl)pyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 154946377 |
| Molecular Formula | C34H59N3 |
| Molecular Weight | 509.87 g/mol |
| Exact Mass | 509.47 |
| IUPAC Name | 2-(5-methyldodecan-5-yl)-4-(7-methyltridecan-7-yl)pyrido[3,2-d]pyrimidine |
| SMILES | CCCCCCCC(C)(CCCC)c1nc(C(C)(CCCCCC)CCCCCC)c2ncccc2n1 |
| InChI | InChI=1S/C34H59N3/c1-7-11-15-18-21-27-34(6,24-14-10-4)32-36-29-23-22-28-35-30(29)31(37-32)33(5,25-19-16-12-8-2)26-20-17-13-9-3/h22-23,28H,7-21,24-27H2,1-6H3 |
| InChIKey | AJMIFZIAMNPBEO-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.87 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|