About bis(2-aminoacetic acid);dichloroplatinum
bis(2-aminoacetic acid);dichloroplatinum (PubChem CID 15494954) has the molecular formula C4H10Cl2N2O4Pt
and a molecular weight of 416.12 g/mol. Its IUPAC name is bis(2-aminoacetic acid);dichloroplatinum.
Molecular Properties
| Compound Name | bis(2-aminoacetic acid);dichloroplatinum |
| PubChem CID | 15494954 |
| Molecular Formula | C4H10Cl2N2O4Pt |
| Molecular Weight | 416.12 g/mol |
| Exact Mass | 414.97 |
| IUPAC Name | bis(2-aminoacetic acid);dichloroplatinum |
| SMILES | Cl[Pt]Cl.NCC(=O)O.NCC(=O)O |
| InChI | InChI=1S/2C2H5NO2.2ClH.Pt/c2*3-1-2(4)5;;;/h2*1,3H2,(H,4,5);2*1H;/q;;;;+2/p-2 |
| InChIKey | YCCUMPSQDRWJTC-UHFFFAOYSA-L |
| XLogP | -0.56 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.12 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-aminoacetic acid);dichloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-aminoacetic acid);dichloroplatinum?
The IUPAC name of bis(2-aminoacetic acid);dichloroplatinum (CID 15494954) is bis(2-aminoacetic acid);dichloroplatinum.
What is the SMILES notation for bis(2-aminoacetic acid);dichloroplatinum?
The canonical SMILES for bis(2-aminoacetic acid);dichloroplatinum is Cl[Pt]Cl.NCC(=O)O.NCC(=O)O.
What is the InChIKey of bis(2-aminoacetic acid);dichloroplatinum?
The InChIKey is YCCUMPSQDRWJTC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H5NO2.2ClH.Pt/c2*3-1-2(4)5;;;/h2*1,3H2,(H,4,5);2*1H;/q;;;;+2/p-2.
What are the key properties of bis(2-aminoacetic acid);dichloroplatinum?
bis(2-aminoacetic acid);dichloroplatinum has a molecular weight of 416.12 g/mol, XLogP of -0.56, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-aminoacetic acid);dichloroplatinum is sourced from PubChem (CID 15494954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).