C25H23FN4O3 — CID 154950292
4-[4-[3-(3-fluoro-5-methoxyanilino)-2-hydroxypyrrolidin-1-yl]phenyl]-2H-phthalazin-1-one (PubChem CID 154950292) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is 4-[4-[3-(3-fluoro-5-methoxyanilino)-2-hydroxypyrrolidin-1-yl]phenyl]-2H-phthalazin-1-one.
| Compound Name | 4-[4-[3-(3-fluoro-5-methoxyanilino)-2-hydroxypyrrolidin-1-yl]phenyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 154950292 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-[4-[3-(3-fluoro-5-methoxyanilino)-2-hydroxypyrrolidin-1-yl]phenyl]-2H-phthalazin-1-one |
| SMILES | COc1cc(F)cc(NC2CCN(c3ccc(-c4n[nH]c(=O)c5ccccc45)cc3)C2O)c1 |
| InChI | InChI=1S/C25H23FN4O3/c1-33-19-13-16(26)12-17(14-19)27-22-10-11-30(25(22)32)18-8-6-15(7-9-18)23-20-4-2-3-5-21(20)24(31)29-28-23/h2-9,12-14,22,25,27,32H,10-11H2,1H3,(H,29,31) |
| InChIKey | COIWLEIBTLVIDH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |