C25H20F2N4O3 — CID 139531371
4-[4-[3-[4-(difluoromethoxy)anilino]-2-oxopyrrolidin-1-yl]phenyl]-2H-phthalazin-1-one (PubChem CID 139531371) has the molecular formula C25H20F2N4O3 and a molecular weight of 462.46 g/mol. Its IUPAC name is 4-[4-[3-[4-(difluoromethoxy)anilino]-2-oxopyrrolidin-1-yl]phenyl]-2H-phthalazin-1-one.
| Compound Name | 4-[4-[3-[4-(difluoromethoxy)anilino]-2-oxopyrrolidin-1-yl]phenyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 139531371 |
| Molecular Formula | C25H20F2N4O3 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 4-[4-[3-[4-(difluoromethoxy)anilino]-2-oxopyrrolidin-1-yl]phenyl]-2H-phthalazin-1-one |
| SMILES | O=C1C(Nc2ccc(OC(F)F)cc2)CCN1c1ccc(-c2n[nH]c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H20F2N4O3/c26-25(27)34-18-11-7-16(8-12-18)28-21-13-14-31(24(21)33)17-9-5-15(6-10-17)22-19-3-1-2-4-20(19)23(32)30-29-22/h1-12,21,25,28H,13-14H2,(H,30,32) |
| InChIKey | SBMUMSMPESKHJY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|