C23H27BF2N2O4 — CID 145438875
3-[3-(difluoromethoxy)anilino]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-2-one (PubChem CID 145438875) has the molecular formula C23H27BF2N2O4 and a molecular weight of 444.29 g/mol. Its IUPAC name is 3-[3-(difluoromethoxy)anilino]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-2-one.
| Compound Name | 3-[3-(difluoromethoxy)anilino]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 145438875 |
| Molecular Formula | C23H27BF2N2O4 |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-[3-(difluoromethoxy)anilino]-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidin-2-one |
| SMILES | CC1(C)OB(c2ccc(N3CCC(Nc4cccc(OC(F)F)c4)C3=O)cc2)OC1(C)C |
| InChI | InChI=1S/C23H27BF2N2O4/c1-22(2)23(3,4)32-24(31-22)15-8-10-17(11-9-15)28-13-12-19(20(28)29)27-16-6-5-7-18(14-16)30-21(25)26/h5-11,14,19,21,27H,12-13H2,1-4H3 |
| InChIKey | BPNSQNNIVJDBFE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|