About N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide
N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide (PubChem CID 154954325) has the molecular formula C21H26N2O4
and a molecular weight of 370.45 g/mol. Its IUPAC name is N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide.
Molecular Properties
| Compound Name | N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide |
| PubChem CID | 154954325 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide |
| SMILES | CC(=O)NC(=O)C1CCCC2CC(CCC1)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C21H26N2O4/c1-14(24)22-19(25)15-7-5-9-16-13-17(10-6-8-15)21(27)23(20(16)26)18-11-3-2-4-12-18/h2-4,11-12,15-17H,5-10,13H2,1H3,(H,22,24,25) |
| InChIKey | SJJXYZLEFYWDCM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide?
The IUPAC name of N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide (CID 154954325) is N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide.
What is the SMILES notation for N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide?
The canonical SMILES for N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide is CC(=O)NC(=O)C1CCCC2CC(CCC1)C(=O)N(c1ccccc1)C2=O.
What is the InChIKey of N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide?
The InChIKey is SJJXYZLEFYWDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O4/c1-14(24)22-19(25)15-7-5-9-16-13-17(10-6-8-15)21(27)23(20(16)26)18-11-3-2-4-12-18/h2-4,11-12,15-17H,5-10,13H2,1H3,(H,22,24,25).
What are the key properties of N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide?
N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide has a molecular weight of 370.45 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-10,12-dioxo-11-phenyl-11-azabicyclo[7.3.1]tridecane-5-carboxamide is sourced from PubChem (CID 154954325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).