C17H22ClFN4O2 — CID 154956265
ethyl (2S,3S)-3-[[[[amino(chloro)methylidene]amino]-(3-fluoro-1H-pyrrol-2-yl)methylidene]amino]bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 154956265) has the molecular formula C17H22ClFN4O2 and a molecular weight of 368.84 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[[[[amino(chloro)methylidene]amino]-(3-fluoro-1H-pyrrol-2-yl)methylidene]amino]bicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[[[[amino(chloro)methylidene]amino]-(3-fluoro-1H-pyrrol-2-yl)methylidene]amino]bicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 154956265 |
| Molecular Formula | C17H22ClFN4O2 |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethyl (2S,3S)-3-[[[[amino(chloro)methylidene]amino]-(3-fluoro-1H-pyrrol-2-yl)methylidene]amino]bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C2CCC(CC2)[C@@H]1/N=C(\N=C(\N)Cl)c1[nH]ccc1F |
| InChI | InChI=1S/C17H22ClFN4O2/c1-2-25-16(24)12-9-3-5-10(6-4-9)13(12)22-15(23-17(18)20)14-11(19)7-8-21-14/h7-10,12-13,21H,2-6H2,1H3,(H2,20,22,23)/t9?,10?,12-,13-/m0/s1 |
| InChIKey | YVAMVEGZNKBMMP-HFCHRNICSA-N |
| XLogP | 2.82 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|