About 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole
4-but-3-enyl-1,3,5-trimethyl-2H-imidazole (PubChem CID 154959631) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole |
| PubChem CID | 154959631 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole |
| SMILES | C=CCCC1=C(C)N(C)CN1C |
| InChI | InChI=1S/C10H18N2/c1-5-6-7-10-9(2)11(3)8-12(10)4/h5H,1,6-8H2,2-4H3 |
| InChIKey | SLUFJFOPRPOBRB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole?
The IUPAC name of 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole (CID 154959631) is 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole.
What is the SMILES notation for 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole?
The canonical SMILES for 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole is C=CCCC1=C(C)N(C)CN1C.
What is the InChIKey of 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole?
The InChIKey is SLUFJFOPRPOBRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-5-6-7-10-9(2)11(3)8-12(10)4/h5H,1,6-8H2,2-4H3.
What are the key properties of 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole?
4-but-3-enyl-1,3,5-trimethyl-2H-imidazole has a molecular weight of 166.27 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enyl-1,3,5-trimethyl-2H-imidazole is sourced from PubChem (CID 154959631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).