C30H34N6 — CID 154959950
N'-[1-[4-[[3-(4-but-3-ynylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylphenyl]ethenyl]pentane-1,5-diamine (PubChem CID 154959950) has the molecular formula C30H34N6 and a molecular weight of 478.64 g/mol. Its IUPAC name is N'-[1-[4-[[3-(4-but-3-ynylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylphenyl]ethenyl]pentane-1,5-diamine.
| Compound Name | N'-[1-[4-[[3-(4-but-3-ynylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylphenyl]ethenyl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 154959950 |
| Molecular Formula | C30H34N6 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | N'-[1-[4-[[3-(4-but-3-ynylphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-methylphenyl]ethenyl]pentane-1,5-diamine |
| SMILES | C#CCCc1ccc(-c2cnc3c(Nc4ccc(C(=C)NCCCCCN)c(C)c4)nccn23)cc1 |
| InChI | InChI=1S/C30H34N6/c1-4-5-9-24-10-12-25(13-11-24)28-21-34-30-29(33-18-19-36(28)30)35-26-14-15-27(22(2)20-26)23(3)32-17-8-6-7-16-31/h1,10-15,18-21,32H,3,5-9,16-17,31H2,2H3,(H,33,35) |
| InChIKey | PFXHSHLWYDGNGB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|