C4H14N2O8P2 — CID 154961544
2-methyl-4,5-dihydro-1H-imidazole;phosphoric acid (PubChem CID 154961544) has the molecular formula C4H14N2O8P2 and a molecular weight of 280.11 g/mol. Its IUPAC name is 2-methyl-4,5-dihydro-1H-imidazole;phosphoric acid.
| Compound Name | 2-methyl-4,5-dihydro-1H-imidazole;phosphoric acid |
|---|---|
| PubChem CID | 154961544 |
| Molecular Formula | C4H14N2O8P2 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-methyl-4,5-dihydro-1H-imidazole;phosphoric acid |
| SMILES | CC1=NCCN1.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C4H8N2.2H3O4P/c1-4-5-2-3-6-4;2*1-5(2,3)4/h2-3H2,1H3,(H,5,6);2*(H3,1,2,3,4) |
| InChIKey | FXGAOLOGWFUNEC-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 179.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|