C13H13F — CID 154971229
5-fluoro-2-methyl-1-phenylcyclohexa-1,3-diene (PubChem CID 154971229) has the molecular formula C13H13F and a molecular weight of 188.25 g/mol. Its IUPAC name is 5-fluoro-2-methyl-1-phenylcyclohexa-1,3-diene.
| Compound Name | 5-fluoro-2-methyl-1-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 154971229 |
| Molecular Formula | C13H13F |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 5-fluoro-2-methyl-1-phenylcyclohexa-1,3-diene |
| SMILES | CC1=C(c2ccccc2)CC(F)C=C1 |
| InChI | InChI=1S/C13H13F/c1-10-7-8-12(14)9-13(10)11-5-3-2-4-6-11/h2-8,12H,9H2,1H3 |
| InChIKey | ILCZDALKOYPRTD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |