C18H33NO4 — CID 154975000
N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2-(7-methyl-3-bicyclo[3.3.1]nonanyl)acetamide (PubChem CID 154975000) has the molecular formula C18H33NO4 and a molecular weight of 327.47 g/mol. Its IUPAC name is N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2-(7-methyl-3-bicyclo[3.3.1]nonanyl)acetamide.
| Compound Name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2-(7-methyl-3-bicyclo[3.3.1]nonanyl)acetamide |
|---|---|
| PubChem CID | 154975000 |
| Molecular Formula | C18H33NO4 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-2-(7-methyl-3-bicyclo[3.3.1]nonanyl)acetamide |
| SMILES | CC1CC2CC(CC(=O)NCCOCCOCCO)CC(C1)C2 |
| InChI | InChI=1S/C18H33NO4/c1-14-8-15-10-16(9-14)12-17(11-15)13-18(21)19-2-4-22-6-7-23-5-3-20/h14-17,20H,2-13H2,1H3,(H,19,21) |
| InChIKey | BZHSPCGWOVOBHS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|