C21H39NO5 — CID 166943535
N-[2-[2-[2-[(3,5-dimethyl-1-bicyclo[5.1.1]nonanyl)oxy]ethoxy]ethoxy]ethyl]-4-hydroxybutanamide (PubChem CID 166943535) has the molecular formula C21H39NO5 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[2-[2-[2-[(3,5-dimethyl-1-bicyclo[5.1.1]nonanyl)oxy]ethoxy]ethoxy]ethyl]-4-hydroxybutanamide.
| Compound Name | N-[2-[2-[2-[(3,5-dimethyl-1-bicyclo[5.1.1]nonanyl)oxy]ethoxy]ethoxy]ethyl]-4-hydroxybutanamide |
|---|---|
| PubChem CID | 166943535 |
| Molecular Formula | C21H39NO5 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | N-[2-[2-[2-[(3,5-dimethyl-1-bicyclo[5.1.1]nonanyl)oxy]ethoxy]ethoxy]ethyl]-4-hydroxybutanamide |
| SMILES | CC1CC(C)CC2(OCCOCCOCCNC(=O)CCCO)CC(C1)C2 |
| InChI | InChI=1S/C21H39NO5/c1-17-12-18(2)14-21(15-19(13-17)16-21)27-11-10-26-9-8-25-7-5-22-20(24)4-3-6-23/h17-19,23H,3-16H2,1-2H3,(H,22,24) |
| InChIKey | UHGRCAYAEBEISP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|