C14H16F2N2O3S — CID 154980972
4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluorobutanehydrazide (PubChem CID 154980972) has the molecular formula C14H16F2N2O3S and a molecular weight of 330.36 g/mol. Its IUPAC name is 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluorobutanehydrazide.
| Compound Name | 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluorobutanehydrazide |
|---|---|
| PubChem CID | 154980972 |
| Molecular Formula | C14H16F2N2O3S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluorobutanehydrazide |
| SMILES | COc1cc2cc(C(F)(F)CCC(=O)NN)sc2cc1OC |
| InChI | InChI=1S/C14H16F2N2O3S/c1-20-9-5-8-6-12(22-11(8)7-10(9)21-2)14(15,16)4-3-13(19)18-17/h5-7H,3-4,17H2,1-2H3,(H,18,19) |
| InChIKey | SSXCEHHXDJXDHY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|