C22H21F4NO4S — CID 164708072
N-(1,2-difluoro-1-phenylethyl)-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluoro-N-hydroxybutanamide (PubChem CID 164708072) has the molecular formula C22H21F4NO4S and a molecular weight of 471.47 g/mol. Its IUPAC name is N-(1,2-difluoro-1-phenylethyl)-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluoro-N-hydroxybutanamide.
| Compound Name | N-(1,2-difluoro-1-phenylethyl)-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluoro-N-hydroxybutanamide |
|---|---|
| PubChem CID | 164708072 |
| Molecular Formula | C22H21F4NO4S |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-(1,2-difluoro-1-phenylethyl)-4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4,4-difluoro-N-hydroxybutanamide |
| SMILES | COc1cc2cc(C(F)(F)CCC(=O)N(O)C(F)(CF)c3ccccc3)sc2cc1OC |
| InChI | InChI=1S/C22H21F4NO4S/c1-30-16-10-14-11-19(32-18(14)12-17(16)31-2)21(24,25)9-8-20(28)27(29)22(26,13-23)15-6-4-3-5-7-15/h3-7,10-12,29H,8-9,13H2,1-2H3 |
| InChIKey | MOADRFQBGGEIQC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|